Synonym(s): 9-cis,12-cis-Linoleic acid; cis-9,cis-12-Octadecadienoic acid; Telfairic acid
Formula: CH3(CH2)4CH=CHCH2CH=CH(CH2)7CO2H
Formula Weight: 280.45
CAS No.: 60-33-3
Purity: ≥99%
Density: 0.902g/mLat 25°C(lit.)
Application: Fatty acid that is typically bound to a carrier molecule such as BSA or cyclodextrin for use in cell culture.
Storage: −20°C
Packaging: Sealed ampule.
Beilstein Registry Number: 1727101
EC No.: 200-470-9
Boiling Point: 229-230°C/16mmHg(lit.)
Melting Point: −5°C(lit.)
Refractive Index: n20/D 1.466(lit.)
Biochem/physiol Actions: Linoleic acid increases cell proliferation and gene expression of PPARα and its target genes such as acyl-CoA oxidase in primary duck hepatocytes 1.
Empirical Formula (Hill Notation): C4H10S